What is the structure of 2 5 Dimethylheptane?
What is the structure of 2 5 Dimethylheptane?
2,5-Dimethylheptane | C9H20 | ChemSpider.
What is C5H12 in chemistry?
Pentane is an organic compound with the formula C5H12—that is, an alkane with five carbon atoms.
What is the common name of hexane 2 4 Dione?
2,4-Hexanedione
PubChem CID | 76355 |
---|---|
Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
Molecular Formula | C6H10O2 |
Synonyms | 2,4-Hexanedione hexane-2,4-dione 3002-24-2 Propionylacetone Acetone, propionyl- More… |
Molecular Weight | 114.14 |
What is the condensed structural formula for 4 Isopropyloctane?
Identification of 4-ISOPROPYLOCTANE Chemical Compound
Chemical Formula | C11H24 |
---|---|
IUPAC Name | 4-(propan-2-yl)octane |
SMILES String | CCCCC(CCC)C(C)C |
InChI | InChI=1S/C11H24/c1-5-7-9-11(8-6-2)10(3)4/h10-11H,5-9H2,1-4H3 |
InChIKey | VSJAVEFYQMREHJ-UHFFFAOYSA-N |
Is heptane an organic solvent?
Heptane is a straight-chain alkane with seven carbon atoms. It has been found in Jeffrey pine (Pinus jeffreyi). It has a role as a non-polar solvent and a plant metabolite. It is a volatile organic compound and an alkane.
What is the name of c5h12?
Pentane
Pentane/IUPAC ID
What is the chemical c5h10?
Cyclopentane (also called C pentane) is a highly flammable alicyclic hydrocarbon with chemical formula C5H10 and CAS number 287-92-3, consisting of a ring of five carbon atoms each bonded with two hydrogen atoms above and below the plane. It occurs as a colorless liquid with a petrol-like odor.
What is the structure of 4 Propyloctane?
Identification of 4-propyloctane Chemical Compound
Chemical Formula | C11H24 |
---|---|
Molecular Weight | 156.30826 g/mol |
IUPAC Name | 4-propyloctane |
SMILES String | CCCCC(CCC)CCC |
InChI | InChI=1S/C11H24/c1-4-7-10-11(8-5-2)9-6-3/h11H,4-10H2,1-3H3 |