What is the chemical name of C3H6O?
What is the chemical name of C3H6O?
IUPAC Name | propan-2-one |
---|---|
Alternative Names | 2-propanone propanone Dimethyl ketone |
Molecular Formula | C3H6O |
Molar Mass | 58.08 g/mol |
InChI | InChI=1S/C3H6O/c1-3(2)4/h1-2H3 |
What does C3H6O mean?
acetone
Ketones. Propanone or acetone, CH3-CO-CH3, CAS number 67-64-1.
What is the chemical name for acetone?
propanone
Acetone, or propanone, is an organic compound with the formula (CH3)2CO. It is the simplest and smallest ketone. It is a colourless, highly volatile and flammable liquid with a characteristic pungent odour.
Is C3H6O an aldehyde?
Aldehydes and ketones are two compounds which contain the carbonyl group. For example, the aldehyde and ketone below both have the molecular formula C3H6O. C3H6O. The simplest aldehyde is methanal, commonly known as formaldehyde, and used as a preservative.
What is formula of chloroform?
CHCl₃
Chloroform/Formula
Is C3H6O an alcohol?
It is a primary allylic alcohol and a propenol.
What shape is C3H6O?
Dihedral
Acetone
Names | |
---|---|
Coordination geometry | Trigonal planar at C2 |
Molecular shape | Dihedral at C2 |
Dipole moment | 2.91 D |
Thermochemistry |
What is another name for acetone?
acetone (CH3COCH3), also called 2-propanone or dimethyl ketone, organic solvent of industrial and chemical significance, the simplest and most important of the aliphatic (fat-derived) ketones. Pure acetone is a colourless, somewhat aromatic, flammable, mobile liquid that boils at 56.2 °C (133 °F).
What is the other name of acetone?
Acetone is a manufactured chemical that is also found naturally in the environment. It is a colorless liquid with a distinct smell and taste. It evaporates easily, is flammable, and dissolves in water. It is also called dimethyl ketone, 2-propanone, and beta-ketopropane.
Is acetone an aldehyde or ketone?
Also called aldehyde. Acetone (propanone) is a colorless, volatile, extremely flammable liquid ketone, CH3COCH3, widely used as an organic solvent….IUPAC Rules for Naming Ketones.
Propanone (acetone) | Butanone (methyl ethyl ketone) |
---|---|
Acetophenone | Benzophenone |
Is C3H6O a ketone?
Acetone (C3H6O, CAS 67-64-1), also known as dimethyl ketone or 2-propanone, is the simplest ketone. A colorless, volatile, and flammable liquid with a distinct odor, acetone can be found naturally in trees and various other plants.