What is the density 2 4 pentanedione?
What is the density 2 4 pentanedione?
980 kg/m³
Acetylacetone/Density
What is the molar mass of 2 4 pentanedione?
100.13 g/mol
Acetylacetone/Molar mass
What is the pKa of 2 4 pentanedione?
8.51
3D Structure for HMDB0031648 (2,4-Pentanedione)
| Property | Value | Source |
|---|---|---|
| pKa (Strongest Acidic) | 8.51 | ChemAxon |
| pKa (Strongest Basic) | -7.1 | ChemAxon |
| Physiological Charge | 0 | ChemAxon |
| Hydrogen Acceptor Count | 2 | ChemAxon |
What is the formula of acetylacetone?
C5H8O2
Acetylacetone/Formula
What is the structural formula of pentane 2 4-Dione?
What is the common name of hexane 2 4-Dione?
2,4-Hexanedione
| PubChem CID | 76355 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C6H10O2 |
| Synonyms | 2,4-Hexanedione hexane-2,4-dione 3002-24-2 Propionylacetone Acetone, propionyl- More… |
| Molecular Weight | 114.14 |
What is the pKa value of acetyl acetone?
9.40
ABSTRACT The dissociation constant pKa of acetylacetone has been determined potentiometrically. The pKa value obtained is 9.40, indicating a weak acid.
What is the pKa of benzene?
43
Ionization Constants of Carbon Acids
| Common Name | Formula | pKa |
|---|---|---|
| benzene | C6H6 | 43 |
| ethene | C2H4 | 44 |
| cyclopropane | C3H6 | 46 |
| ethane | C2H6 | 48 |
How do you make acetylacetone?
Acetylacetone has been prepared by the reaction of acetyl chloride with aluminum chloride, followed by hydrolysis;3 by the condensation of acetone with ethyl acetate in the presence of sodium,4 sodium amide,5,6 sodium ethoxide,5,7,8 and alkali or alkaline-earth hydrides;9 by the reaction of acetone and acetic anhydride …
What is the Iupac name of acetylacetone?
| IUPAC Name | pentane-2,4-dione |
|---|---|
| Alternative Names | 2,4-Pentanedione Acetylacetone Pentane-2,4-dione Acetoacetone Diacetylmethane 2,4-Dioxopentane |
| Molecular Formula | C5H8O2 |
| Molar Mass | 100.117 g/mol |
| InChI | InChI=1S/C5H8O2/c1-4(6)3-5(2)7/h3H2,1-2H3 |
What type of molecule is acetylacetone?
A β-diketone that is pentane in which the hydrogens at positions 2 and 4 are replaced by oxo groups. Acetylacetone is an organic compound with the chemical formula CH3COCH2COCH3. It is a colorless liquid, classified as a 1,3-diketone.
What is the reactivity profile of pentane-2, 4-dione?
Reactivity Profile Ketones, such as PENTANE-2,4-DIONE, are reactive with many acids and bases liberating heat and flammable gases (e.g., H2). The amount of heat may be sufficient to start a fire in the unreacted portion of the ketone.
What are the dangers of pentane-2, 4-dione?
Hazards. Ketones, such as PENTANE-2,4-DIONE, are reactive with many acids and bases liberating heat and flammable gases (e.g., H2). The amount of heat may be sufficient to start a fire in the unreacted portion of the ketone. Ketones react with reducing agents such as hydrides, alkali metals, and nitrides to produce flammable gas (H2) and heat.
What kind of liquid is 2, 3 pentanedione?
IDENTIFICATION AND USE: 2,3-Pentanedione is a yellow liquid. It is used as flavoring agent (butter flavoring) including many e-cigarette brands. HUMAN EXPOSURE AND TOXICITY: Inhalation of butter flavoring by workers in the microwave popcorn industry may result in “popcorn workers’ lung.”.
Where can I find pentane 2, 3 Dione?
Pentane-2,3-dione is an alpha-diketone that is pentane substituted at the 2- and 3-positions by oxo groups. It has a role as a flavouring agent. It is an alpha-diketone and a methyl ketone. It derives from a hydride of a pentane. 2, 3-Pentanedione is found in cereals and cereal products.
https://www.youtube.com/watch?v=73_aMmd53ts